C17H23NO3 — CID 71460477
ethyl 5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]-1,2-oxazole-3-carboxylate (PubChem CID 71460477) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl 5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 71460477 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl 5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(/C=C/C2C(C)=CCCC2(C)C)on1 |
| InChI | InChI=1S/C17H23NO3/c1-5-20-16(19)15-11-13(21-18-15)8-9-14-12(2)7-6-10-17(14,3)4/h7-9,11,14H,5-6,10H2,1-4H3/b9-8+ |
| InChIKey | FFNORFWXOXQKKO-CMDGGOBGSA-N |
| XLogP | 4.25 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|