C52H42N4O4 — CID 71460796
1,2-bis(7-oxo-6,9-diphenyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl)ethane-1,2-dione (PubChem CID 71460796) has the molecular formula C52H42N4O4 and a molecular weight of 786.93 g/mol. Its IUPAC name is 1,2-bis(7-oxo-6,9-diphenyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl)ethane-1,2-dione.
| Compound Name | 1,2-bis(7-oxo-6,9-diphenyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 71460796 |
| Molecular Formula | C52H42N4O4 |
| Molecular Weight | 786.93 g/mol |
| Exact Mass | 786.32 |
| IUPAC Name | 1,2-bis(7-oxo-6,9-diphenyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-5-yl)ethane-1,2-dione |
| SMILES | O=C1CC(c2ccccc2)CC2=C1C(c1ccccc1)N(C(=O)C(=O)N1c3ccccc3NC3=C(C(=O)CC(c4ccccc4)C3)C1c1ccccc1)c1ccccc1N2 |
| InChI | InChI=1S/C52H42N4O4/c57-45-31-37(33-17-5-1-6-18-33)29-41-47(45)49(35-21-9-3-10-22-35)55(43-27-15-13-25-39(43)53-41)51(59)52(60)56-44-28-16-14-26-40(44)54-42-30-38(34-19-7-2-8-20-34)32-46(58)48(42)50(56)36-23-11-4-12-24-36/h1-28,37-38,49-50,53-54H,29-32H2 |
| InChIKey | VSTPVGPTBHNWOT-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.93 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|