C27H25ClFNO6 — CID 71460928
methyl N-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]carbamate (PubChem CID 71460928) has the molecular formula C27H25ClFNO6 and a molecular weight of 513.95 g/mol. Its IUPAC name is methyl N-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]carbamate.
| Compound Name | methyl N-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]carbamate |
|---|---|
| PubChem CID | 71460928 |
| Molecular Formula | C27H25ClFNO6 |
| Molecular Weight | 513.95 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | methyl N-[(1S,3S,3aR,8bS)-3a-(4-chlorophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]carbamate |
| SMILES | COC(=O)N[C@H]1C[C@@H](c2cccc(F)c2)[C@]2(c3ccc(Cl)cc3)Oc3cc(OC)cc(OC)c3[C@]12O |
| InChI | InChI=1S/C27H25ClFNO6/c1-33-19-12-21(34-2)24-22(13-19)36-27(16-7-9-17(28)10-8-16)20(15-5-4-6-18(29)11-15)14-23(26(24,27)32)30-25(31)35-3/h4-13,20,23,32H,14H2,1-3H3,(H,30,31)/t20-,23-,26+,27-/m0/s1 |
| InChIKey | BRQYDEUIFACDDZ-MNUJBRLQSA-N |
| XLogP | 4.88 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.95 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |