About 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine
5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine (PubChem CID 71460938) has the molecular formula C15H14FN3OS
and a molecular weight of 303.36 g/mol. Its IUPAC name is 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine |
| PubChem CID | 71460938 |
| Molecular Formula | C15H14FN3OS |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine |
| SMILES | CNc1ccc(-c2nc3ccc(OCCF)cc3s2)cn1 |
| InChI | InChI=1S/C15H14FN3OS/c1-17-14-5-2-10(9-18-14)15-19-12-4-3-11(20-7-6-16)8-13(12)21-15/h2-5,8-9H,6-7H2,1H3,(H,17,18) |
| InChIKey | VSBHDTPIFLEPGY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine?
The IUPAC name of 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine (CID 71460938) is 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine.
What is the SMILES notation for 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine?
The canonical SMILES for 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine is CNc1ccc(-c2nc3ccc(OCCF)cc3s2)cn1.
What is the InChIKey of 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine?
The InChIKey is VSBHDTPIFLEPGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14FN3OS/c1-17-14-5-2-10(9-18-14)15-19-12-4-3-11(20-7-6-16)8-13(12)21-15/h2-5,8-9H,6-7H2,1H3,(H,17,18).
What are the key properties of 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine?
5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine has a molecular weight of 303.36 g/mol, XLogP of 3.75, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-(2-fluoroethoxy)-1,3-benzothiazol-2-yl]-N-methylpyridin-2-amine is sourced from PubChem (CID 71460938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).