C24H21F2N3O6 — CID 71460969
5-[[4-[1-[4-(difluoromethoxy)benzoyl]piperidin-4-yl]oxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 71460969) has the molecular formula C24H21F2N3O6 and a molecular weight of 485.44 g/mol. Its IUPAC name is 5-[[4-[1-[4-(difluoromethoxy)benzoyl]piperidin-4-yl]oxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[4-[1-[4-(difluoromethoxy)benzoyl]piperidin-4-yl]oxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 71460969 |
| Molecular Formula | C24H21F2N3O6 |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 5-[[4-[1-[4-(difluoromethoxy)benzoyl]piperidin-4-yl]oxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=Cc2ccc(OC3CCN(C(=O)c4ccc(OC(F)F)cc4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C24H21F2N3O6/c25-23(26)35-17-7-3-15(4-8-17)22(32)29-11-9-18(10-12-29)34-16-5-1-14(2-6-16)13-19-20(30)27-24(33)28-21(19)31/h1-8,13,18,23H,9-12H2,(H2,27,28,30,31,33) |
| InChIKey | ZGNWUBFFSBCIPI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|