C18H17N5O2 — CID 71461087
N-[(2-methoxyphenyl)methyl]-3-methyl-5-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-5-ium-8-amine (PubChem CID 71461087) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-3-methyl-5-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-5-ium-8-amine.
| Compound Name | N-[(2-methoxyphenyl)methyl]-3-methyl-5-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-5-ium-8-amine |
|---|---|
| PubChem CID | 71461087 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-3-methyl-5-oxidopyrazolo[5,1-c][1,2,4]benzotriazin-5-ium-8-amine |
| SMILES | COc1ccccc1CNc1ccc2c(c1)n1ncc(C)c1n[n+]2[O-] |
| InChI | InChI=1S/C18H17N5O2/c1-12-10-20-22-16-9-14(7-8-15(16)23(24)21-18(12)22)19-11-13-5-3-4-6-17(13)25-2/h3-10,19H,11H2,1-2H3 |
| InChIKey | WRLYBFVBKJJANB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|