About 6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide
6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide (PubChem CID 71461141) has the molecular formula C35H34BrO3P
and a molecular weight of 613.53 g/mol. Its IUPAC name is 6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide.
Molecular Properties
| Compound Name | 6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide |
| PubChem CID | 71461141 |
| Molecular Formula | C35H34BrO3P |
| Molecular Weight | 613.53 g/mol |
| Exact Mass | 612.14 |
| IUPAC Name | 6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide |
| SMILES | CC1=C(OCCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)c2ccccc2C1=O.[Br-] |
| InChI | InChI=1S/C35H34O3P.BrH/c1-27-33(36)31-23-13-14-24-32(31)34(37)35(27)38-25-15-2-3-16-26-39(28-17-7-4-8-18-28,29-19-9-5-10-20-29)30-21-11-6-12-22-30;/h4-14,17-24H,2-3,15-16,25-26H2,1H3;1H/q+1;/p-1 |
| InChIKey | KJZNHNWNEZBUKT-UHFFFAOYSA-M |
| XLogP | 3.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 613.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide?
The IUPAC name of 6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide (CID 71461141) is 6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide.
What is the SMILES notation for 6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide?
The canonical SMILES for 6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide is CC1=C(OCCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)c2ccccc2C1=O.[Br-].
What is the InChIKey of 6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide?
The InChIKey is KJZNHNWNEZBUKT-UHFFFAOYSA-M. The full InChI is InChI=1S/C35H34O3P.BrH/c1-27-33(36)31-23-13-14-24-32(31)34(37)35(27)38-25-15-2-3-16-26-39(28-17-7-4-8-18-28,29-19-9-5-10-20-29)30-21-11-6-12-22-30;/h4-14,17-24H,2-3,15-16,25-26H2,1H3;1H/q+1;/p-1.
What are the key properties of 6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide?
6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide has a molecular weight of 613.53 g/mol, XLogP of 3.91, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-methyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium bromide is sourced from PubChem (CID 71461141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).