About methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate
methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate (PubChem CID 71461164) has the molecular formula C16H19NO7S
and a molecular weight of 369.40 g/mol. Its IUPAC name is methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate.
Molecular Properties
| Compound Name | methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate |
| PubChem CID | 71461164 |
| Molecular Formula | C16H19NO7S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate |
| SMILES | COC(=O)[C@@H](N)CSC(=O)C(Cc1ccc2c(c1)OCO2)OC(C)=O |
| InChI | InChI=1S/C16H19NO7S/c1-9(18)24-14(16(20)25-7-11(17)15(19)21-2)6-10-3-4-12-13(5-10)23-8-22-12/h3-5,11,14H,6-8,17H2,1-2H3/t11-,14?/m0/s1 |
| InChIKey | PRBQZEFYNIYZPQ-ZSOXZCCMSA-N |
| XLogP | 0.65 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate?
The IUPAC name of methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate (CID 71461164) is methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate.
What is the SMILES notation for methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate?
The canonical SMILES for methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate is COC(=O)[C@@H](N)CSC(=O)C(Cc1ccc2c(c1)OCO2)OC(C)=O.
What is the InChIKey of methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate?
The InChIKey is PRBQZEFYNIYZPQ-ZSOXZCCMSA-N. The full InChI is InChI=1S/C16H19NO7S/c1-9(18)24-14(16(20)25-7-11(17)15(19)21-2)6-10-3-4-12-13(5-10)23-8-22-12/h3-5,11,14H,6-8,17H2,1-2H3/t11-,14?/m0/s1.
What are the key properties of methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate?
methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate has a molecular weight of 369.40 g/mol, XLogP of 0.65, 7 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-3-[2-acetyloxy-3-(1,3-benzodioxol-5-yl)propanoyl]sulfanyl-2-aminopropanoate is sourced from PubChem (CID 71461164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).