C27H34INO — CID 71461268
[4-(3-acetylphenyl)phenyl]methyl-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium iodide (PubChem CID 71461268) has the molecular formula C27H34INO and a molecular weight of 515.48 g/mol. Its IUPAC name is [4-(3-acetylphenyl)phenyl]methyl-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium iodide.
| Compound Name | [4-(3-acetylphenyl)phenyl]methyl-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium iodide |
|---|---|
| PubChem CID | 71461268 |
| Molecular Formula | C27H34INO |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | [4-(3-acetylphenyl)phenyl]methyl-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium iodide |
| SMILES | CC(=O)c1cccc(-c2ccc(C[N+](C)(C)CC3=CC[C@H]4C[C@@H]3C4(C)C)cc2)c1.[I-] |
| InChI | InChI=1S/C27H34NO.HI/c1-19(29)22-7-6-8-23(15-22)21-11-9-20(10-12-21)17-28(4,5)18-24-13-14-25-16-26(24)27(25,2)3;/h6-13,15,25-26H,14,16-18H2,1-5H3;1H/q+1;/p-1/t25-,26-;/m0./s1 |
| InChIKey | LUNWKDKOTHXBHZ-CCQIZPNASA-M |
| XLogP | 3.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|