C19H27N3O4 — CID 71461297
benzyl N-[4-[(2S,5S)-3,6-dioxo-5-propan-2-ylpiperazin-2-yl]butyl]carbamate (PubChem CID 71461297) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is benzyl N-[4-[(2S,5S)-3,6-dioxo-5-propan-2-ylpiperazin-2-yl]butyl]carbamate.
| Compound Name | benzyl N-[4-[(2S,5S)-3,6-dioxo-5-propan-2-ylpiperazin-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 71461297 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | benzyl N-[4-[(2S,5S)-3,6-dioxo-5-propan-2-ylpiperazin-2-yl]butyl]carbamate |
| SMILES | CC(C)[C@@H]1NC(=O)[C@H](CCCCNC(=O)OCc2ccccc2)NC1=O |
| InChI | InChI=1S/C19H27N3O4/c1-13(2)16-18(24)21-15(17(23)22-16)10-6-7-11-20-19(25)26-12-14-8-4-3-5-9-14/h3-5,8-9,13,15-16H,6-7,10-12H2,1-2H3,(H,20,25)(H,21,24)(H,22,23)/t15-,16-/m0/s1 |
| InChIKey | CZCUUIDLIRWWQQ-HOTGVXAUSA-N |
| XLogP | 1.72 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|