C24H25F3N4O5S — CID 71461399
(3R)-3-amino-N-[4-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxothian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide (PubChem CID 71461399) has the molecular formula C24H25F3N4O5S and a molecular weight of 538.55 g/mol. Its IUPAC name is (3R)-3-amino-N-[4-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxothian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide.
| Compound Name | (3R)-3-amino-N-[4-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxothian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide |
|---|---|
| PubChem CID | 71461399 |
| Molecular Formula | C24H25F3N4O5S |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | (3R)-3-amino-N-[4-[5-(3-methoxyphenyl)-1,3,4-oxadiazol-2-yl]-1,1-dioxothian-4-yl]-4-(2,4,5-trifluorophenyl)butanamide |
| SMILES | COc1cccc(-c2nnc(C3(NC(=O)C[C@H](N)Cc4cc(F)c(F)cc4F)CCS(=O)(=O)CC3)o2)c1 |
| InChI | InChI=1S/C24H25F3N4O5S/c1-35-17-4-2-3-14(10-17)22-30-31-23(36-22)24(5-7-37(33,34)8-6-24)29-21(32)12-16(28)9-15-11-19(26)20(27)13-18(15)25/h2-4,10-11,13,16H,5-9,12,28H2,1H3,(H,29,32)/t16-/m1/s1 |
| InChIKey | LUJUVXYDOJRBAL-MRXNPFEDSA-N |
| XLogP | 2.64 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|