About (3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane
(3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane (PubChem CID 71461581) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is (3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | (3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane |
| PubChem CID | 71461581 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane |
| SMILES | Cc1ncc([C@@H]2CN3CCC2C3)nc1C |
| InChI | InChI=1S/C12H17N3/c1-8-9(2)14-12(5-13-8)11-7-15-4-3-10(11)6-15/h5,10-11H,3-4,6-7H2,1-2H3/t10?,11-/m1/s1 |
| InChIKey | PMZINWVPTQJZLT-RRKGBCIJSA-N |
| XLogP | 1.51 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane?
The IUPAC name of (3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane (CID 71461581) is (3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane.
What is the SMILES notation for (3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane?
The canonical SMILES for (3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane is Cc1ncc([C@@H]2CN3CCC2C3)nc1C.
What is the InChIKey of (3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane?
The InChIKey is PMZINWVPTQJZLT-RRKGBCIJSA-N. The full InChI is InChI=1S/C12H17N3/c1-8-9(2)14-12(5-13-8)11-7-15-4-3-10(11)6-15/h5,10-11H,3-4,6-7H2,1-2H3/t10?,11-/m1/s1.
What are the key properties of (3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane?
(3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane has a molecular weight of 203.29 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(5,6-dimethylpyrazin-2-yl)-1-azabicyclo[2.2.1]heptane is sourced from PubChem (CID 71461581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).