C12H16N2 — CID 71461603
(4R,10aR)-4-methyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole (PubChem CID 71461603) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (4R,10aR)-4-methyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole.
| Compound Name | (4R,10aR)-4-methyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole |
|---|---|
| PubChem CID | 71461603 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (4R,10aR)-4-methyl-1,2,3,4,10,10a-hexahydropyrazino[1,2-a]indole |
| SMILES | C[C@@H]1CNC[C@H]2Cc3ccccc3N21 |
| InChI | InChI=1S/C12H16N2/c1-9-7-13-8-11-6-10-4-2-3-5-12(10)14(9)11/h2-5,9,11,13H,6-8H2,1H3/t9-,11-/m1/s1 |
| InChIKey | NITMFLAGDPNBNV-MWLCHTKSSA-N |
| XLogP | 1.41 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |