C22H23NO4 — CID 71461723
(6S,10bS)-6-phenyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;(E)-but-2-enedioic acid (PubChem CID 71461723) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is (6S,10bS)-6-phenyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;(E)-but-2-enedioic acid.
| Compound Name | (6S,10bS)-6-phenyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 71461723 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (6S,10bS)-6-phenyl-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;(E)-but-2-enedioic acid |
| SMILES | O=C(O)/C=C/C(=O)O.c1ccc([C@@H]2CN3CCC[C@H]3c3ccccc32)cc1 |
| InChI | InChI=1S/C18H19N.C4H4O4/c1-2-7-14(8-3-1)17-13-19-12-6-11-18(19)16-10-5-4-9-15(16)17;5-3(6)1-2-4(7)8/h1-5,7-10,17-18H,6,11-13H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t17-,18-;/m0./s1 |
| InChIKey | SJNKFNUCFFSVAH-JMWOCPPISA-N |
| XLogP | 3.68 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|