C29H30ClN3 — CID 71461780
2-(10-chloroanthracen-9-yl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 71461780) has the molecular formula C29H30ClN3 and a molecular weight of 456.03 g/mol. Its IUPAC name is 2-(10-chloroanthracen-9-yl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine.
| Compound Name | 2-(10-chloroanthracen-9-yl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 71461780 |
| Molecular Formula | C29H30ClN3 |
| Molecular Weight | 456.03 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-(10-chloroanthracen-9-yl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | CC(C)(C)CC(C)(C)Nc1c(-c2c3ccccc3c(Cl)c3ccccc23)nc2ccccn12 |
| InChI | InChI=1S/C29H30ClN3/c1-28(2,3)18-29(4,5)32-27-26(31-23-16-10-11-17-33(23)27)24-19-12-6-8-14-21(19)25(30)22-15-9-7-13-20(22)24/h6-17,32H,18H2,1-5H3 |
| InChIKey | KAFJFGXTSREWPL-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.03 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|