C19H13NO4S — CID 71461947
(5Z)-5-[[4-[(E)-3-(4-hydroxyphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 71461947) has the molecular formula C19H13NO4S and a molecular weight of 351.38 g/mol. Its IUPAC name is (5Z)-5-[[4-[(E)-3-(4-hydroxyphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[(E)-3-(4-hydroxyphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 71461947 |
| Molecular Formula | C19H13NO4S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | (5Z)-5-[[4-[(E)-3-(4-hydroxyphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2ccc(/C=C/C(=O)c3ccc(O)cc3)cc2)S1 |
| InChI | InChI=1S/C19H13NO4S/c21-15-8-6-14(7-9-15)16(22)10-5-12-1-3-13(4-2-12)11-17-18(23)20-19(24)25-17/h1-11,21H,(H,20,23,24)/b10-5+,17-11- |
| InChIKey | VFSOLERTOZBNNJ-JRVPMJJVSA-N |
| XLogP | 3.61 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|