C25H33ClN2O4 — CID 71461979
N-[(4-chlorophenyl)methyl]-2-[(3R,8E,11S)-3-cyclohexyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetamide (PubChem CID 71461979) has the molecular formula C25H33ClN2O4 and a molecular weight of 461.00 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-[(3R,8E,11S)-3-cyclohexyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-[(3R,8E,11S)-3-cyclohexyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetamide |
|---|---|
| PubChem CID | 71461979 |
| Molecular Formula | C25H33ClN2O4 |
| Molecular Weight | 461.00 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-[(3R,8E,11S)-3-cyclohexyl-5,12-dioxo-1-oxa-4-azacyclododec-8-en-11-yl]acetamide |
| SMILES | O=C(C[C@@H]1C/C=C/CCC(=O)N[C@H](C2CCCCC2)COC1=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H33ClN2O4/c26-21-13-11-18(12-14-21)16-27-24(30)15-20-9-5-2-6-10-23(29)28-22(17-32-25(20)31)19-7-3-1-4-8-19/h2,5,11-14,19-20,22H,1,3-4,6-10,15-17H2,(H,27,30)(H,28,29)/b5-2+/t20-,22-/m0/s1 |
| InChIKey | RTDDGSNRJAMSBI-BQIDRLATSA-N |
| XLogP | 4.31 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.00 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|