C25H26ClNO — CID 71462061
(E)-3-(5-chloro-1H-indol-3-yl)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one (PubChem CID 71462061) has the molecular formula C25H26ClNO and a molecular weight of 391.94 g/mol. Its IUPAC name is (E)-3-(5-chloro-1H-indol-3-yl)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(5-chloro-1H-indol-3-yl)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71462061 |
| Molecular Formula | C25H26ClNO |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (E)-3-(5-chloro-1H-indol-3-yl)-1-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-en-1-one |
| SMILES | CC1(C)CCC(C)(C)c2cc(C(=O)/C=C/c3c[nH]c4ccc(Cl)cc34)ccc21 |
| InChI | InChI=1S/C25H26ClNO/c1-24(2)11-12-25(3,4)21-13-16(5-8-20(21)24)23(28)10-6-17-15-27-22-9-7-18(26)14-19(17)22/h5-10,13-15,27H,11-12H2,1-4H3/b10-6+ |
| InChIKey | ABZDZJCXZAOMMJ-UXBLZVDNSA-N |
| XLogP | 7.07 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|