C16H13ClN4O2 — CID 71462105
1-[(4-chlorophenyl)methyl]-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea (PubChem CID 71462105) has the molecular formula C16H13ClN4O2 and a molecular weight of 328.76 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea |
|---|---|
| PubChem CID | 71462105 |
| Molecular Formula | C16H13ClN4O2 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea |
| SMILES | O=C(NCc1ccc(Cl)cc1)Nc1cnc2ccccn2c1=O |
| InChI | InChI=1S/C16H13ClN4O2/c17-12-6-4-11(5-7-12)9-19-16(23)20-13-10-18-14-3-1-2-8-21(14)15(13)22/h1-8,10H,9H2,(H2,19,20,23) |
| InChIKey | PHANIBHANNYTFG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |