C19H19FN6 — CID 71462198
6-(3-fluorophenyl)-4-methyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyridazine (PubChem CID 71462198) has the molecular formula C19H19FN6 and a molecular weight of 350.40 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-4-methyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyridazine.
| Compound Name | 6-(3-fluorophenyl)-4-methyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyridazine |
|---|---|
| PubChem CID | 71462198 |
| Molecular Formula | C19H19FN6 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 6-(3-fluorophenyl)-4-methyl-3-(4-pyrimidin-2-ylpiperazin-1-yl)pyridazine |
| SMILES | Cc1cc(-c2cccc(F)c2)nnc1N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H19FN6/c1-14-12-17(15-4-2-5-16(20)13-15)23-24-18(14)25-8-10-26(11-9-25)19-21-6-3-7-22-19/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | MHWXOBIGQFEWCA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |