About 4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline
4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline (PubChem CID 71462568) has the molecular formula C16H14INO
and a molecular weight of 361.20 g/mol. Its IUPAC name is 4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline.
Molecular Properties
| Compound Name | 4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline |
| PubChem CID | 71462568 |
| Molecular Formula | C16H14INO |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline |
| SMILES | CN(C)c1ccc(-c2cc3cc([125I])ccc3o2)cc1 |
| InChI | InChI=1S/C16H14INO/c1-18(2)14-6-3-11(4-7-14)16-10-12-9-13(17)5-8-15(12)19-16/h3-10H,1-2H3/i17-2 |
| InChIKey | XHGHCGPWSCLUGT-QZIRHQCUSA-N |
| XLogP | 4.77 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline?
The IUPAC name of 4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline (CID 71462568) is 4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline.
What is the SMILES notation for 4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline?
The canonical SMILES for 4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline is CN(C)c1ccc(-c2cc3cc([125I])ccc3o2)cc1.
What is the InChIKey of 4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline?
The InChIKey is XHGHCGPWSCLUGT-QZIRHQCUSA-N. The full InChI is InChI=1S/C16H14INO/c1-18(2)14-6-3-11(4-7-14)16-10-12-9-13(17)5-8-15(12)19-16/h3-10H,1-2H3/i17-2.
What are the key properties of 4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline?
4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline has a molecular weight of 361.20 g/mol, XLogP of 4.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-(125I)iodo-1-benzofuran-2-yl)-N,N-dimethyl(125I)aniline is sourced from PubChem (CID 71462568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).