About 4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol
4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol (PubChem CID 71462585) has the molecular formula C23H18FNO3
and a molecular weight of 375.40 g/mol. Its IUPAC name is 4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol.
Molecular Properties
| Compound Name | 4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol |
| PubChem CID | 71462585 |
| Molecular Formula | C23H18FNO3 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol |
| SMILES | Cn1c(-c2ccc(O)cc2F)cc(-c2ccc(O)cc2)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C23H18FNO3/c1-25-22(19-11-10-18(28)12-21(19)24)13-20(14-2-6-16(26)7-3-14)23(25)15-4-8-17(27)9-5-15/h2-13,26-28H,1H3 |
| InChIKey | XOZVRDQYDBYITO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol?
The IUPAC name of 4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol (CID 71462585) is 4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol.
What is the SMILES notation for 4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol?
The canonical SMILES for 4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol is Cn1c(-c2ccc(O)cc2F)cc(-c2ccc(O)cc2)c1-c1ccc(O)cc1.
What is the InChIKey of 4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol?
The InChIKey is XOZVRDQYDBYITO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18FNO3/c1-25-22(19-11-10-18(28)12-21(19)24)13-20(14-2-6-16(26)7-3-14)23(25)15-4-8-17(27)9-5-15/h2-13,26-28H,1H3.
What are the key properties of 4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol?
4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol has a molecular weight of 375.40 g/mol, XLogP of 5.28, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4,5-bis(4-hydroxyphenyl)-1-methylpyrrol-2-yl]-3-fluorophenol is sourced from PubChem (CID 71462585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).