C20H21N5O4 — CID 71462593
5-[[2-[[4-(dimethylamino)phenyl]carbamoylamino]acetyl]amino]-1H-indole-2-carboxylic acid (PubChem CID 71462593) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is 5-[[2-[[4-(dimethylamino)phenyl]carbamoylamino]acetyl]amino]-1H-indole-2-carboxylic acid.
| Compound Name | 5-[[2-[[4-(dimethylamino)phenyl]carbamoylamino]acetyl]amino]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 71462593 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 5-[[2-[[4-(dimethylamino)phenyl]carbamoylamino]acetyl]amino]-1H-indole-2-carboxylic acid |
| SMILES | CN(C)c1ccc(NC(=O)NCC(=O)Nc2ccc3[nH]c(C(=O)O)cc3c2)cc1 |
| InChI | InChI=1S/C20H21N5O4/c1-25(2)15-6-3-13(4-7-15)23-20(29)21-11-18(26)22-14-5-8-16-12(9-14)10-17(24-16)19(27)28/h3-10,24H,11H2,1-2H3,(H,22,26)(H,27,28)(H2,21,23,29) |
| InChIKey | BNGFTKWOLOLBGI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|