C26H24BrFN2O5 — CID 71462633
[(1S,3S,3aR,8bS)-3a-(4-bromophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]urea (PubChem CID 71462633) has the molecular formula C26H24BrFN2O5 and a molecular weight of 543.39 g/mol. Its IUPAC name is [(1S,3S,3aR,8bS)-3a-(4-bromophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]urea.
| Compound Name | [(1S,3S,3aR,8bS)-3a-(4-bromophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]urea |
|---|---|
| PubChem CID | 71462633 |
| Molecular Formula | C26H24BrFN2O5 |
| Molecular Weight | 543.39 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | [(1S,3S,3aR,8bS)-3a-(4-bromophenyl)-3-(3-fluorophenyl)-8b-hydroxy-6,8-dimethoxy-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-1-yl]urea |
| SMILES | COc1cc(OC)c2c(c1)O[C@@]1(c3ccc(Br)cc3)[C@H](c3cccc(F)c3)C[C@H](NC(N)=O)[C@@]21O |
| InChI | InChI=1S/C26H24BrFN2O5/c1-33-18-11-20(34-2)23-21(12-18)35-26(15-6-8-16(27)9-7-15)19(14-4-3-5-17(28)10-14)13-22(25(23,26)32)30-24(29)31/h3-12,19,22,32H,13H2,1-2H3,(H3,29,30,31)/t19-,22-,25+,26-/m0/s1 |
| InChIKey | COXCUSIMDYWIIS-NQCABUFKSA-N |
| XLogP | 4.31 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |