C23H29ClN4O — CID 71462661
1-methyl-N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]indazole-3-carboxamide;hydrochloride (PubChem CID 71462661) has the molecular formula C23H29ClN4O and a molecular weight of 412.97 g/mol. Its IUPAC name is 1-methyl-N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]indazole-3-carboxamide;hydrochloride.
| Compound Name | 1-methyl-N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]indazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 71462661 |
| Molecular Formula | C23H29ClN4O |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-methyl-N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]indazole-3-carboxamide;hydrochloride |
| SMILES | Cl.Cn1nc(C(=O)NCC2CCN(CCc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C23H28N4O.ClH/c1-26-21-10-6-5-9-20(21)22(25-26)23(28)24-17-19-12-15-27(16-13-19)14-11-18-7-3-2-4-8-18;/h2-10,19H,11-17H2,1H3,(H,24,28);1H |
| InChIKey | MWOWQWRAYMUPOP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |