C32H34N4O4 — CID 71462732
1,2-bis(9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)ethane-1,2-dione (PubChem CID 71462732) has the molecular formula C32H34N4O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is 1,2-bis(9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)ethane-1,2-dione.
| Compound Name | 1,2-bis(9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 71462732 |
| Molecular Formula | C32H34N4O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 1,2-bis(9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepin-5-yl)ethane-1,2-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1ccccc1N(C(=O)C(=O)N1CC3=C(CC(C)(C)CC3=O)Nc3ccccc31)C2 |
| InChI | InChI=1S/C32H34N4O4/c1-31(2)13-23-19(27(37)15-31)17-35(25-11-7-5-9-21(25)33-23)29(39)30(40)36-18-20-24(14-32(3,4)16-28(20)38)34-22-10-6-8-12-26(22)36/h5-12,33-34H,13-18H2,1-4H3 |
| InChIKey | OUMIPKBUGNYVSL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|