About 3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one
3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one (PubChem CID 71462765) has the molecular formula C25H22N2O3S
and a molecular weight of 430.53 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one |
| PubChem CID | 71462765 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one |
| SMILES | Cn1c2c(cc(S(=O)(=O)c3ccccc3)c1=O)CCc1cn(Cc3ccccc3)cc1-2 |
| InChI | InChI=1S/C25H22N2O3S/c1-26-24-19(14-23(25(26)28)31(29,30)21-10-6-3-7-11-21)12-13-20-16-27(17-22(20)24)15-18-8-4-2-5-9-18/h2-11,14,16-17H,12-13,15H2,1H3 |
| InChIKey | QQDQDROYLPTZOA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one?
The IUPAC name of 3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one (CID 71462765) is 3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one.
What is the SMILES notation for 3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one?
The canonical SMILES for 3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one is Cn1c2c(cc(S(=O)(=O)c3ccccc3)c1=O)CCc1cn(Cc3ccccc3)cc1-2.
What is the InChIKey of 3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one?
The InChIKey is QQDQDROYLPTZOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N2O3S/c1-26-24-19(14-23(25(26)28)31(29,30)21-10-6-3-7-11-21)12-13-20-16-27(17-22(20)24)15-18-8-4-2-5-9-18/h2-11,14,16-17H,12-13,15H2,1H3.
What are the key properties of 3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one?
3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one has a molecular weight of 430.53 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-8-benzyl-1-methyl-5,6-dihydropyrrolo[3,4-h]quinolin-2-one is sourced from PubChem (CID 71462765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).