C38H34Cl2N8O2S — CID 71462901
2-N',5-N'-bis[[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]methyl]-3,4-dimethylthiophene-2,5-dicarbohydrazide (PubChem CID 71462901) has the molecular formula C38H34Cl2N8O2S and a molecular weight of 737.72 g/mol. Its IUPAC name is 2-N',5-N'-bis[[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]methyl]-3,4-dimethylthiophene-2,5-dicarbohydrazide.
| Compound Name | 2-N',5-N'-bis[[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]methyl]-3,4-dimethylthiophene-2,5-dicarbohydrazide |
|---|---|
| PubChem CID | 71462901 |
| Molecular Formula | C38H34Cl2N8O2S |
| Molecular Weight | 737.72 g/mol |
| Exact Mass | 736.19 |
| IUPAC Name | 2-N',5-N'-bis[[1-[(2-chlorophenyl)methyl]benzimidazol-2-yl]methyl]-3,4-dimethylthiophene-2,5-dicarbohydrazide |
| SMILES | Cc1c(C(=O)NNCc2nc3ccccc3n2Cc2ccccc2Cl)sc(C(=O)NNCc2nc3ccccc3n2Cc2ccccc2Cl)c1C |
| InChI | InChI=1S/C38H34Cl2N8O2S/c1-23-24(2)36(38(50)46-42-20-34-44-30-16-8-10-18-32(30)48(34)22-26-12-4-6-14-28(26)40)51-35(23)37(49)45-41-19-33-43-29-15-7-9-17-31(29)47(33)21-25-11-3-5-13-27(25)39/h3-18,41-42H,19-22H2,1-2H3,(H,45,49)(H,46,50) |
| InChIKey | YAXFGEIEAFJIHI-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 117.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.72 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|