C23H31N3O3 — CID 71462951
4-oxo-4-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylamino]butanoic acid (PubChem CID 71462951) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-oxo-4-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylamino]butanoic acid.
| Compound Name | 4-oxo-4-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylamino]butanoic acid |
|---|---|
| PubChem CID | 71462951 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 4-oxo-4-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexylamino]butanoic acid |
| SMILES | O=C(O)CCC(=O)NCCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C23H31N3O3/c27-21(13-14-22(28)29)24-15-7-1-2-8-16-25-23-17-9-3-5-11-19(17)26-20-12-6-4-10-18(20)23/h3,5,9,11H,1-2,4,6-8,10,12-16H2,(H,24,27)(H,25,26)(H,28,29) |
| InChIKey | YFQNCPFXYSSUEF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|