C14H22O6 — CID 71462966
[(3S,4R,5R)-4,5-dihydroxy-6-oxo-3-pentoxycyclohexen-1-yl]methyl acetate (PubChem CID 71462966) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is [(3S,4R,5R)-4,5-dihydroxy-6-oxo-3-pentoxycyclohexen-1-yl]methyl acetate.
| Compound Name | [(3S,4R,5R)-4,5-dihydroxy-6-oxo-3-pentoxycyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 71462966 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [(3S,4R,5R)-4,5-dihydroxy-6-oxo-3-pentoxycyclohexen-1-yl]methyl acetate |
| SMILES | CCCCCO[C@H]1C=C(COC(C)=O)C(=O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H22O6/c1-3-4-5-6-19-11-7-10(8-20-9(2)15)12(16)14(18)13(11)17/h7,11,13-14,17-18H,3-6,8H2,1-2H3/t11-,13-,14-/m0/s1 |
| InChIKey | UDGPOZYFBDKARL-UBHSHLNASA-N |
| XLogP | 0.36 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|