About 4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile
4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile (PubChem CID 71462972) has the molecular formula C13H14N2S
and a molecular weight of 230.34 g/mol. Its IUPAC name is 4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile |
| PubChem CID | 71462972 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile |
| SMILES | CC(C)CCSc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C13H14N2S/c1-10(2)5-6-16-13-4-3-11(8-14)12(7-13)9-15/h3-4,7,10H,5-6H2,1-2H3 |
| InChIKey | LOFGBGBCVMZHMR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile?
The IUPAC name of 4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile (CID 71462972) is 4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile is CC(C)CCSc1ccc(C#N)c(C#N)c1.
What is the InChIKey of 4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile?
The InChIKey is LOFGBGBCVMZHMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2S/c1-10(2)5-6-16-13-4-3-11(8-14)12(7-13)9-15/h3-4,7,10H,5-6H2,1-2H3.
What are the key properties of 4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile?
4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile has a molecular weight of 230.34 g/mol, XLogP of 3.57, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylbutylsulfanyl)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 71462972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).