C27H34INO2 — CID 71462992
[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-[[4-(3-methoxycarbonylphenyl)phenyl]methyl]-dimethylazanium iodide (PubChem CID 71462992) has the molecular formula C27H34INO2 and a molecular weight of 531.48 g/mol. Its IUPAC name is [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-[[4-(3-methoxycarbonylphenyl)phenyl]methyl]-dimethylazanium iodide.
| Compound Name | [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-[[4-(3-methoxycarbonylphenyl)phenyl]methyl]-dimethylazanium iodide |
|---|---|
| PubChem CID | 71462992 |
| Molecular Formula | C27H34INO2 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | [(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl-[[4-(3-methoxycarbonylphenyl)phenyl]methyl]-dimethylazanium iodide |
| SMILES | COC(=O)c1cccc(-c2ccc(C[N+](C)(C)CC3=CC[C@H]4C[C@@H]3C4(C)C)cc2)c1.[I-] |
| InChI | InChI=1S/C27H34NO2.HI/c1-27(2)24-14-13-23(25(27)16-24)18-28(3,4)17-19-9-11-20(12-10-19)21-7-6-8-22(15-21)26(29)30-5;/h6-13,15,24-25H,14,16-18H2,1-5H3;1H/q+1;/p-1/t24-,25-;/m0./s1 |
| InChIKey | DJLYKKIXRUFSHJ-DKIIUIKKSA-M |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|