C27H40N2O2 — CID 71463075
(4R)-4-[(1S,2R,13S,14S,17R,18R)-2,9,9,18-tetramethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,10-trien-17-yl]pentanoic acid (PubChem CID 71463075) has the molecular formula C27H40N2O2 and a molecular weight of 424.63 g/mol. Its IUPAC name is (4R)-4-[(1S,2R,13S,14S,17R,18R)-2,9,9,18-tetramethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,10-trien-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(1S,2R,13S,14S,17R,18R)-2,9,9,18-tetramethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,10-trien-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 71463075 |
| Molecular Formula | C27H40N2O2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | (4R)-4-[(1S,2R,13S,14S,17R,18R)-2,9,9,18-tetramethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,10-trien-17-yl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@@H]3CC=C4C(C)(C)c5[nH]ncc5C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H40N2O2/c1-16(6-11-23(30)31)19-8-9-20-18-7-10-22-25(2,3)24-17(15-28-29-24)14-27(22,5)21(18)12-13-26(19,20)4/h10,15-16,18-21H,6-9,11-14H2,1-5H3,(H,28,29)(H,30,31)/t16-,18+,19-,20+,21+,26-,27-/m1/s1 |
| InChIKey | CJCDUPODHNHJOJ-XNWUTOGOSA-N |
| XLogP | 6.14 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|