C18H21F3N6O — CID 71463137
N-[[3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]acetamide (PubChem CID 71463137) has the molecular formula C18H21F3N6O and a molecular weight of 394.40 g/mol. Its IUPAC name is N-[[3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]acetamide.
| Compound Name | N-[[3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 71463137 |
| Molecular Formula | C18H21F3N6O |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[[3-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1nc2cnc3[nH]ccc3c2n1C1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H21F3N6O/c1-11(28)23-9-15-25-14-8-24-17-13(2-5-22-17)16(14)27(15)12-3-6-26(7-4-12)10-18(19,20)21/h2,5,8,12H,3-4,6-7,9-10H2,1H3,(H,22,24)(H,23,28) |
| InChIKey | RACXBGIDSNEZCG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |