C13H14F3N3O2 — CID 71463305
(4S)-1,3-dimethyl-2-oxo-N-[(2,3,4-trifluorophenyl)methyl]imidazolidine-4-carboxamide (PubChem CID 71463305) has the molecular formula C13H14F3N3O2 and a molecular weight of 301.27 g/mol. Its IUPAC name is (4S)-1,3-dimethyl-2-oxo-N-[(2,3,4-trifluorophenyl)methyl]imidazolidine-4-carboxamide.
| Compound Name | (4S)-1,3-dimethyl-2-oxo-N-[(2,3,4-trifluorophenyl)methyl]imidazolidine-4-carboxamide |
|---|---|
| PubChem CID | 71463305 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (4S)-1,3-dimethyl-2-oxo-N-[(2,3,4-trifluorophenyl)methyl]imidazolidine-4-carboxamide |
| SMILES | CN1C[C@@H](C(=O)NCc2ccc(F)c(F)c2F)N(C)C1=O |
| InChI | InChI=1S/C13H14F3N3O2/c1-18-6-9(19(2)13(18)21)12(20)17-5-7-3-4-8(14)11(16)10(7)15/h3-4,9H,5-6H2,1-2H3,(H,17,20)/t9-/m0/s1 |
| InChIKey | UPPZDUOQXRBECJ-VIFPVBQESA-N |
| XLogP | 1.09 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|