C17H16FN5O5 — CID 71463368
N-[9-(4-fluoro-3,5,6-trihydroxyoxan-2-yl)purin-6-yl]benzamide (PubChem CID 71463368) has the molecular formula C17H16FN5O5 and a molecular weight of 389.34 g/mol. Its IUPAC name is N-[9-(4-fluoro-3,5,6-trihydroxyoxan-2-yl)purin-6-yl]benzamide.
| Compound Name | N-[9-(4-fluoro-3,5,6-trihydroxyoxan-2-yl)purin-6-yl]benzamide |
|---|---|
| PubChem CID | 71463368 |
| Molecular Formula | C17H16FN5O5 |
| Molecular Weight | 389.34 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-[9-(4-fluoro-3,5,6-trihydroxyoxan-2-yl)purin-6-yl]benzamide |
| SMILES | O=C(Nc1ncnc2c1ncn2C1OC(O)C(O)C(F)C1O)c1ccccc1 |
| InChI | InChI=1S/C17H16FN5O5/c18-9-11(24)16(28-17(27)12(9)25)23-7-21-10-13(19-6-20-14(10)23)22-15(26)8-4-2-1-3-5-8/h1-7,9,11-12,16-17,24-25,27H,(H,19,20,22,26) |
| InChIKey | URBXHNSZZLMBOT-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |