About N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide
N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 71463369) has the molecular formula C17H18FN3O6
and a molecular weight of 379.34 g/mol. Its IUPAC name is N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
Molecular Properties
| Compound Name | N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| PubChem CID | 71463369 |
| Molecular Formula | C17H18FN3O6 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | O=C(Nc1ccn(C2OC(CO)C(O)C(F)C2O)c(=O)n1)c1ccccc1 |
| InChI | InChI=1S/C17H18FN3O6/c18-12-13(23)10(8-22)27-16(14(12)24)21-7-6-11(20-17(21)26)19-15(25)9-4-2-1-3-5-9/h1-7,10,12-14,16,22-24H,8H2,(H,19,20,25,26) |
| InChIKey | PUCZITRLESUWFB-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide?
The IUPAC name of N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide (CID 71463369) is N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
What is the SMILES notation for N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide?
The canonical SMILES for N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide is O=C(Nc1ccn(C2OC(CO)C(O)C(F)C2O)c(=O)n1)c1ccccc1.
What is the InChIKey of N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide?
The InChIKey is PUCZITRLESUWFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN3O6/c18-12-13(23)10(8-22)27-16(14(12)24)21-7-6-11(20-17(21)26)19-15(25)9-4-2-1-3-5-9/h1-7,10,12-14,16,22-24H,8H2,(H,19,20,25,26).
What are the key properties of N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide?
N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide has a molecular weight of 379.34 g/mol, XLogP of -0.55, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[4-fluoro-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-oxopyrimidin-4-yl]benzamide is sourced from PubChem (CID 71463369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).