C32H52N2O2+2 — CID 71463409
(2R)-1-[4-[(2R)-2-hydroxy-7-phenylheptyl]-1,4-dimethylpiperazine-1,4-diium-1-yl]-7-phenylheptan-2-ol (PubChem CID 71463409) has the molecular formula C32H52N2O2+2 and a molecular weight of 496.78 g/mol. Its IUPAC name is (2R)-1-[4-[(2R)-2-hydroxy-7-phenylheptyl]-1,4-dimethylpiperazine-1,4-diium-1-yl]-7-phenylheptan-2-ol.
| Compound Name | (2R)-1-[4-[(2R)-2-hydroxy-7-phenylheptyl]-1,4-dimethylpiperazine-1,4-diium-1-yl]-7-phenylheptan-2-ol |
|---|---|
| PubChem CID | 71463409 |
| Molecular Formula | C32H52N2O2+2 |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 496.40 |
| IUPAC Name | (2R)-1-[4-[(2R)-2-hydroxy-7-phenylheptyl]-1,4-dimethylpiperazine-1,4-diium-1-yl]-7-phenylheptan-2-ol |
| SMILES | C[N+]1(C[C@H](O)CCCCCc2ccccc2)CC[N+](C)(C[C@H](O)CCCCCc2ccccc2)CC1 |
| InChI | InChI=1S/C32H52N2O2/c1-33(27-31(35)21-13-5-11-19-29-15-7-3-8-16-29)23-25-34(2,26-24-33)28-32(36)22-14-6-12-20-30-17-9-4-10-18-30/h3-4,7-10,15-18,31-32,35-36H,5-6,11-14,19-28H2,1-2H3/q+2/t31-,32-,33?,34?/m1/s1 |
| InChIKey | YZOARLJSCAVKBT-UJTVJLQXSA-N |
| XLogP | 5.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|