About 2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine
2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine (PubChem CID 71463520) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine |
| PubChem CID | 71463520 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine |
| SMILES | CCc1[nH]c2ccncc2c1CCN |
| InChI | InChI=1S/C11H15N3/c1-2-10-8(3-5-12)9-7-13-6-4-11(9)14-10/h4,6-7,14H,2-3,5,12H2,1H3 |
| InChIKey | MQLGWXQXEYRQPX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine?
The IUPAC name of 2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine (CID 71463520) is 2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine.
What is the SMILES notation for 2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine?
The canonical SMILES for 2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine is CCc1[nH]c2ccncc2c1CCN.
What is the InChIKey of 2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine?
The InChIKey is MQLGWXQXEYRQPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-2-10-8(3-5-12)9-7-13-6-4-11(9)14-10/h4,6-7,14H,2-3,5,12H2,1H3.
What are the key properties of 2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine?
2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine has a molecular weight of 189.26 g/mol, XLogP of 1.63, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethyl-1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine is sourced from PubChem (CID 71463520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).