About Cathepsin Inhibitor, Column 5 Row 3
Cathepsin Inhibitor, Column 5 Row 3 (PubChem CID 71463536) has the molecular formula C32H33N5O4
and a molecular weight of 551.60 g/mol. Its IUPAC name is N-[(2S)-3-methyl-1-oxo-1-[[3-oxo-4-[[2-(3-pyridin-2-ylphenyl)acetyl]amino]butan-2-yl]amino]butan-2-yl]quinoline-2-carboxamide.
Molecular Properties
| Compound Name | Cathepsin Inhibitor, Column 5 Row 3 |
| PubChem CID | 71463536 |
| Molecular Formula | C32H33N5O4 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | N-[(2S)-3-methyl-1-oxo-1-[[3-oxo-4-[[2-(3-pyridin-2-ylphenyl)acetyl]amino]butan-2-yl]amino]butan-2-yl]quinoline-2-carboxamide |
| SMILES | CC(C)[C@@H](C(=O)NC(C)C(=O)CNC(=O)CC1=CC(=CC=C1)C2=CC=CC=N2)NC(=O)C3=NC4=CC=CC=C4C=C3 |
| InChI | InChI=1S/C32H33N5O4/c1-20(2)30(37-31(40)27-15-14-23-10-4-5-13-26(23)36-27)32(41)35-21(3)28(38)19-34-29(39)18-22-9-8-11-24(17-22)25-12-6-7-16-33-25/h4-17,20-21,30H,18-19H2,1-3H3,(H,34,39)(H,35,41)(H,37,40)/t21?,30-/m0/s1 |
| InChIKey | YIQBVWDVYGNREK-LOGQOBJBSA-N |
| XLogP | 4.20 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | 911 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze Cathepsin Inhibitor, Column 5 Row 3 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Cathepsin Inhibitor, Column 5 Row 3?
The IUPAC name of Cathepsin Inhibitor, Column 5 Row 3 (CID 71463536) is N-[(2S)-3-methyl-1-oxo-1-[[3-oxo-4-[[2-(3-pyridin-2-ylphenyl)acetyl]amino]butan-2-yl]amino]butan-2-yl]quinoline-2-carboxamide.
What is the SMILES notation for Cathepsin Inhibitor, Column 5 Row 3?
The canonical SMILES for Cathepsin Inhibitor, Column 5 Row 3 is CC(C)[C@@H](C(=O)NC(C)C(=O)CNC(=O)CC1=CC(=CC=C1)C2=CC=CC=N2)NC(=O)C3=NC4=CC=CC=C4C=C3.
What is the InChIKey of Cathepsin Inhibitor, Column 5 Row 3?
The InChIKey is YIQBVWDVYGNREK-LOGQOBJBSA-N. The full InChI is InChI=1S/C32H33N5O4/c1-20(2)30(37-31(40)27-15-14-23-10-4-5-13-26(23)36-27)32(41)35-21(3)28(38)19-34-29(39)18-22-9-8-11-24(17-22)25-12-6-7-16-33-25/h4-17,20-21,30H,18-19H2,1-3H3,(H,34,39)(H,35,41)(H,37,40)/t21?,30-/m0/s1.
What are the key properties of Cathepsin Inhibitor, Column 5 Row 3?
Cathepsin Inhibitor, Column 5 Row 3 has a molecular weight of 551.60 g/mol, XLogP of 4.20, 11 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Cathepsin Inhibitor, Column 5 Row 3 is sourced from PubChem (CID 71463536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).