About 5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one
5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one (PubChem CID 71463561) has the molecular formula C21H18O4
and a molecular weight of 334.37 g/mol. Its IUPAC name is 5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one.
Molecular Properties
| Compound Name | 5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one |
| PubChem CID | 71463561 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one |
| SMILES | C=CCc1c(O)c(CC=C)c2oc(=O)cc(-c3ccccc3)c2c1O |
| InChI | InChI=1S/C21H18O4/c1-3-8-14-19(23)15(9-4-2)21-18(20(14)24)16(12-17(22)25-21)13-10-6-5-7-11-13/h3-7,10-12,23-24H,1-2,8-9H2 |
| InChIKey | KDSCNSZCTQKSCH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one?
The IUPAC name of 5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one (CID 71463561) is 5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one.
What is the SMILES notation for 5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one?
The canonical SMILES for 5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one is C=CCc1c(O)c(CC=C)c2oc(=O)cc(-c3ccccc3)c2c1O.
What is the InChIKey of 5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one?
The InChIKey is KDSCNSZCTQKSCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18O4/c1-3-8-14-19(23)15(9-4-2)21-18(20(14)24)16(12-17(22)25-21)13-10-6-5-7-11-13/h3-7,10-12,23-24H,1-2,8-9H2.
What are the key properties of 5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one?
5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one has a molecular weight of 334.37 g/mol, XLogP of 4.33, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydroxy-4-phenyl-6,8-bis(prop-2-enyl)chromen-2-one is sourced from PubChem (CID 71463561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).