C14H11F3N6 — CID 71463580
6-N-methyl-6-N-(3,4,5-trifluorophenyl)pyrido[2,3-d]pyrimidine-2,4,6-triamine (PubChem CID 71463580) has the molecular formula C14H11F3N6 and a molecular weight of 320.28 g/mol. Its IUPAC name is 6-N-methyl-6-N-(3,4,5-trifluorophenyl)pyrido[2,3-d]pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-methyl-6-N-(3,4,5-trifluorophenyl)pyrido[2,3-d]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 71463580 |
| Molecular Formula | C14H11F3N6 |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 6-N-methyl-6-N-(3,4,5-trifluorophenyl)pyrido[2,3-d]pyrimidine-2,4,6-triamine |
| SMILES | CN(c1cc(F)c(F)c(F)c1)c1cnc2nc(N)nc(N)c2c1 |
| InChI | InChI=1S/C14H11F3N6/c1-23(6-3-9(15)11(17)10(16)4-6)7-2-8-12(18)21-14(19)22-13(8)20-5-7/h2-5H,1H3,(H4,18,19,20,21,22) |
| InChIKey | RYXUPKGYPPPMSC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|