C13H21NO3 — CID 71463666
tert-butyl (3aR,7aS)-5-oxo-3,3a,4,6,7,7a-hexahydro-2H-indole-1-carboxylate (PubChem CID 71463666) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is tert-butyl (3aR,7aS)-5-oxo-3,3a,4,6,7,7a-hexahydro-2H-indole-1-carboxylate.
| Compound Name | tert-butyl (3aR,7aS)-5-oxo-3,3a,4,6,7,7a-hexahydro-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 71463666 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | tert-butyl (3aR,7aS)-5-oxo-3,3a,4,6,7,7a-hexahydro-2H-indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]2CC(=O)CC[C@@H]21 |
| InChI | InChI=1S/C13H21NO3/c1-13(2,3)17-12(16)14-7-6-9-8-10(15)4-5-11(9)14/h9,11H,4-8H2,1-3H3/t9-,11+/m1/s1 |
| InChIKey | FAFPNFIAMGOSNB-KOLCDFICSA-N |
| XLogP | 2.37 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |