About (5-methyl-1,3-thiazol-2-yl)boronic acid
(5-methyl-1,3-thiazol-2-yl)boronic acid (PubChem CID 71463789) has the molecular formula C4H6BNO2S
and a molecular weight of 142.98 g/mol. Its IUPAC name is (5-methyl-1,3-thiazol-2-yl)boronic acid.
Molecular Properties
| Compound Name | (5-methyl-1,3-thiazol-2-yl)boronic acid |
| PubChem CID | 71463789 |
| Molecular Formula | C4H6BNO2S |
| Molecular Weight | 142.98 g/mol |
| Exact Mass | 143.02 |
| IUPAC Name | (5-methyl-1,3-thiazol-2-yl)boronic acid |
| SMILES | Cc1cnc(B(O)O)s1 |
| InChI | InChI=1S/C4H6BNO2S/c1-3-2-6-4(9-3)5(7)8/h2,7-8H,1H3 |
| InChIKey | ZPNYSZCITYZMMU-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.98 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-1,3-thiazol-2-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,3-thiazol-2-yl)boronic acid?
The IUPAC name of (5-methyl-1,3-thiazol-2-yl)boronic acid (CID 71463789) is (5-methyl-1,3-thiazol-2-yl)boronic acid.
What is the SMILES notation for (5-methyl-1,3-thiazol-2-yl)boronic acid?
The canonical SMILES for (5-methyl-1,3-thiazol-2-yl)boronic acid is Cc1cnc(B(O)O)s1.
What is the InChIKey of (5-methyl-1,3-thiazol-2-yl)boronic acid?
The InChIKey is ZPNYSZCITYZMMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6BNO2S/c1-3-2-6-4(9-3)5(7)8/h2,7-8H,1H3.
What are the key properties of (5-methyl-1,3-thiazol-2-yl)boronic acid?
(5-methyl-1,3-thiazol-2-yl)boronic acid has a molecular weight of 142.98 g/mol, XLogP of -0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,3-thiazol-2-yl)boronic acid is sourced from PubChem (CID 71463789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).