(5-methyl-1,3-thiazol-2-yl)boronic acid

C4H6BNO2S — CID 71463789

IUPAC(5-methyl-1,3-thiazol-2-yl)boronic acid
SMILESCc1cnc(B(O)O)s1
InChIInChI=1S/C4H6BNO2S/c1-3-2-6-4(9-3)5(7)8/h2,7-8H,1H3
InChIKeyZPNYSZCITYZMMU-UHFFFAOYSA-N
MW142.98 g/mol
LogP-0.87
Rot. Bonds1

About (5-methyl-1,3-thiazol-2-yl)boronic acid

(5-methyl-1,3-thiazol-2-yl)boronic acid (PubChem CID 71463789) has the molecular formula C4H6BNO2S and a molecular weight of 142.98 g/mol. Its IUPAC name is (5-methyl-1,3-thiazol-2-yl)boronic acid.

Molecular Properties

Compound Name(5-methyl-1,3-thiazol-2-yl)boronic acid
PubChem CID71463789
Molecular FormulaC4H6BNO2S
Molecular Weight142.98 g/mol
Exact Mass143.02
IUPAC Name(5-methyl-1,3-thiazol-2-yl)boronic acid
SMILESCc1cnc(B(O)O)s1
InChIInChI=1S/C4H6BNO2S/c1-3-2-6-4(9-3)5(7)8/h2,7-8H,1H3
InChIKeyZPNYSZCITYZMMU-UHFFFAOYSA-N
XLogP-0.87
TPSA53.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.98
LogP ≤ 5-0.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (5-methyl-1,3-thiazol-2-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-methyl-1,3-thiazol-2-yl)boronic acid?
The IUPAC name of (5-methyl-1,3-thiazol-2-yl)boronic acid (CID 71463789) is (5-methyl-1,3-thiazol-2-yl)boronic acid.
What is the SMILES notation for (5-methyl-1,3-thiazol-2-yl)boronic acid?
The canonical SMILES for (5-methyl-1,3-thiazol-2-yl)boronic acid is Cc1cnc(B(O)O)s1.
What is the InChIKey of (5-methyl-1,3-thiazol-2-yl)boronic acid?
The InChIKey is ZPNYSZCITYZMMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6BNO2S/c1-3-2-6-4(9-3)5(7)8/h2,7-8H,1H3.
What are the key properties of (5-methyl-1,3-thiazol-2-yl)boronic acid?
(5-methyl-1,3-thiazol-2-yl)boronic acid has a molecular weight of 142.98 g/mol, XLogP of -0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,3-thiazol-2-yl)boronic acid is sourced from PubChem (CID 71463789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).