About 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride
2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride (PubChem CID 71463958) has the molecular formula C27H36Cl2N2
and a molecular weight of 459.51 g/mol. Its IUPAC name is 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride.
Molecular Properties
| Compound Name | 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride |
| PubChem CID | 71463958 |
| Molecular Formula | C27H36Cl2N2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1Cl.[Cl-] |
| InChI | InChI=1S/C27H36ClN2.ClH/c1-17(2)21-11-9-12-22(18(3)4)25(21)29-15-16-30(27(29)28)26-23(19(5)6)13-10-14-24(26)20(7)8;/h9-20H,1-8H3;1H/q+1;/p-1 |
| InChIKey | JDMACANGISWEGX-UHFFFAOYSA-M |
| XLogP | 4.91 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride?
The IUPAC name of 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride (CID 71463958) is 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride.
What is the SMILES notation for 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride?
The canonical SMILES for 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride is CC(C)c1cccc(C(C)C)c1-n1cc[n+](-c2c(C(C)C)cccc2C(C)C)c1Cl.[Cl-].
What is the InChIKey of 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride?
The InChIKey is JDMACANGISWEGX-UHFFFAOYSA-M. The full InChI is InChI=1S/C27H36ClN2.ClH/c1-17(2)21-11-9-12-22(18(3)4)25(21)29-15-16-30(27(29)28)26-23(19(5)6)13-10-14-24(26)20(7)8;/h9-20H,1-8H3;1H/q+1;/p-1.
What are the key properties of 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride?
2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride has a molecular weight of 459.51 g/mol, XLogP of 4.91, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3-bis[2,6-di(propan-2-yl)phenyl]imidazol-1-ium chloride is sourced from PubChem (CID 71463958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).