About tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride
tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride (PubChem CID 71464197) has the molecular formula C14H27ClN2O2
and a molecular weight of 290.83 g/mol. Its IUPAC name is tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride |
| PubChem CID | 71464197 |
| Molecular Formula | C14H27ClN2O2 |
| Molecular Weight | 290.83 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCNC2)CC1.Cl |
| InChI | InChI=1S/C14H26N2O2.ClH/c1-13(2,3)18-12(17)16-9-6-14(7-10-16)5-4-8-15-11-14;/h15H,4-11H2,1-3H3;1H |
| InChIKey | LPRFEBCQOPCLMH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.83 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride?
The IUPAC name of tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride (CID 71464197) is tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride.
What is the SMILES notation for tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride?
The canonical SMILES for tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride is CC(C)(C)OC(=O)N1CCC2(CCCNC2)CC1.Cl.
What is the InChIKey of tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride?
The InChIKey is LPRFEBCQOPCLMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2.ClH/c1-13(2,3)18-12(17)16-9-6-14(7-10-16)5-4-8-15-11-14;/h15H,4-11H2,1-3H3;1H.
What are the key properties of tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride?
tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride has a molecular weight of 290.83 g/mol, XLogP of 2.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate;hydrochloride is sourced from PubChem (CID 71464197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).