C29H32N4O6S — CID 71464849
[4-[[3-[1-(3-methylbutanoyl)piperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate (PubChem CID 71464849) has the molecular formula C29H32N4O6S and a molecular weight of 564.66 g/mol. Its IUPAC name is [4-[[3-[1-(3-methylbutanoyl)piperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate.
| Compound Name | [4-[[3-[1-(3-methylbutanoyl)piperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate |
|---|---|
| PubChem CID | 71464849 |
| Molecular Formula | C29H32N4O6S |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | [4-[[3-[1-(3-methylbutanoyl)piperidin-4-yl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate |
| SMILES | CC(C)CC(=O)N1CCC(N2C(=O)NC(=O)C2Cc2ccc(OS(=O)(=O)c3cccc4cnccc34)cc2)CC1 |
| InChI | InChI=1S/C29H32N4O6S/c1-19(2)16-27(34)32-14-11-22(12-15-32)33-25(28(35)31-29(33)36)17-20-6-8-23(9-7-20)39-40(37,38)26-5-3-4-21-18-30-13-10-24(21)26/h3-10,13,18-19,22,25H,11-12,14-17H2,1-2H3,(H,31,35,36) |
| InChIKey | MCWKFPZWBIOOFU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|