C18H34O2 — CID 71465049
1,2-bis[(E)-4-methylpent-1-enoxy]hexane (PubChem CID 71465049) has the molecular formula C18H34O2 and a molecular weight of 282.47 g/mol. Its IUPAC name is 1,2-bis[(E)-4-methylpent-1-enoxy]hexane.
| Compound Name | 1,2-bis[(E)-4-methylpent-1-enoxy]hexane |
|---|---|
| PubChem CID | 71465049 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | 1,2-bis[(E)-4-methylpent-1-enoxy]hexane |
| SMILES | CCCCC(CO/C=C/CC(C)C)O/C=C/CC(C)C |
| InChI | InChI=1S/C18H34O2/c1-6-7-12-18(20-14-9-11-17(4)5)15-19-13-8-10-16(2)3/h8-9,13-14,16-18H,6-7,10-12,15H2,1-5H3/b13-8+,14-9+ |
| InChIKey | GQOGPACLLHUOPE-UQNWOCKMSA-N |
| XLogP | 5.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|