C6H17O16P5S5 — CID 71465201
2,3,4,5,6-pentakis(dihydroxyphosphinothioyloxy)cyclohexan-1-ol (PubChem CID 71465201) has the molecular formula C6H17O16P5S5 and a molecular weight of 660.39 g/mol. Its IUPAC name is 2,3,4,5,6-pentakis(dihydroxyphosphinothioyloxy)cyclohexan-1-ol.
| Compound Name | 2,3,4,5,6-pentakis(dihydroxyphosphinothioyloxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 71465201 |
| Molecular Formula | C6H17O16P5S5 |
| Molecular Weight | 660.39 g/mol |
| Exact Mass | 659.78 |
| IUPAC Name | 2,3,4,5,6-pentakis(dihydroxyphosphinothioyloxy)cyclohexan-1-ol |
| SMILES | OC1C(OP(O)(O)=S)C(OP(O)(O)=S)C(OP(O)(O)=S)C(OP(O)(O)=S)C1OP(O)(O)=S |
| InChI | InChI=1S/C6H17O16P5S5/c7-1-2(18-23(8,9)28)4(20-25(12,13)30)6(22-27(16,17)32)5(21-26(14,15)31)3(1)19-24(10,11)29/h1-7H,(H2,8,9,28)(H2,10,11,29)(H2,12,13,30)(H2,14,15,31)(H2,16,17,32) |
| InChIKey | TUIGGSRZLKVGFM-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 268.68 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.39 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|