C30H34N4O7S — CID 71465203
tert-butyl 4-[[5-[(4-isoquinolin-5-ylsulfonyloxyphenyl)methyl]-2,4-dioxoimidazolidin-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 71465203) has the molecular formula C30H34N4O7S and a molecular weight of 594.69 g/mol. Its IUPAC name is tert-butyl 4-[[5-[(4-isoquinolin-5-ylsulfonyloxyphenyl)methyl]-2,4-dioxoimidazolidin-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-[(4-isoquinolin-5-ylsulfonyloxyphenyl)methyl]-2,4-dioxoimidazolidin-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71465203 |
| Molecular Formula | C30H34N4O7S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | tert-butyl 4-[[5-[(4-isoquinolin-5-ylsulfonyloxyphenyl)methyl]-2,4-dioxoimidazolidin-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN2C(=O)NC(=O)C2Cc2ccc(OS(=O)(=O)c3cccc4cnccc34)cc2)CC1 |
| InChI | InChI=1S/C30H34N4O7S/c1-30(2,3)40-29(37)33-15-12-21(13-16-33)19-34-25(27(35)32-28(34)36)17-20-7-9-23(10-8-20)41-42(38,39)26-6-4-5-22-18-31-14-11-24(22)26/h4-11,14,18,21,25H,12-13,15-17,19H2,1-3H3,(H,32,35,36) |
| InChIKey | QJVJIGZAQMLJGH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 135.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|